C20H25F2N7O3 — CID 58000558
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[(5-fluoro-2-pyridinyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000558) has the molecular formula C20H25F2N7O3 and a molecular weight of 449.46 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[(5-fluoro-2-pyridinyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[(5-fluoro-2-pyridinyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000558 |
| Molecular Formula | C20H25F2N7O3 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[(5-fluoro-2-pyridinyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(Nc2ccc(F)cn2)n1 |
| InChI | InChI=1S/C20H25F2N7O3/c1-12-24-18(26-16-7-6-15(21)9-23-16)17(22)19(25-12)27-28-20(31)14(10-29(32)11-30)8-13-4-2-3-5-13/h6-7,9,11,13-14,32H,2-5,8,10H2,1H3,(H,28,31)(H2,23,24,25,26,27)/t14-/m1/s1 |
| InChIKey | MGZFCUZTLBVUQD-CQSZACIVSA-N |
| XLogP | 2.69 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|