C24H32FN7O3 — CID 58000560
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(3-pyridin-3-ylpyrrolidin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000560) has the molecular formula C24H32FN7O3 and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(3-pyridin-3-ylpyrrolidin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(3-pyridin-3-ylpyrrolidin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000560 |
| Molecular Formula | C24H32FN7O3 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(3-pyridin-3-ylpyrrolidin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N2CCC(c3cccnc3)C2)n1 |
| InChI | InChI=1S/C24H32FN7O3/c1-16-27-22(29-30-24(34)20(14-32(35)15-33)11-17-5-2-3-6-17)21(25)23(28-16)31-10-8-19(13-31)18-7-4-9-26-12-18/h4,7,9,12,15,17,19-20,35H,2-3,5-6,8,10-11,13-14H2,1H3,(H,30,34)(H,27,28,29)/t19?,20-/m1/s1 |
| InChIKey | ZECMYGSVILAXGL-GFOWMXPYSA-N |
| XLogP | 2.80 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|