C17H27FN6O4 — CID 87210193
N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[methoxy(methyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 87210193) has the molecular formula C17H27FN6O4 and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[methoxy(methyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[methoxy(methyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87210193 |
| Molecular Formula | C17H27FN6O4 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N-[(2S)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-6-[methoxy(methyl)amino]-2-methylpyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | CON(C)c1nc(C)nc(NNC(=O)[C@@H](CC2CCCC2)CN(O)C=O)c1F |
| InChI | InChI=1S/C17H27FN6O4/c1-11-19-15(14(18)16(20-11)23(2)28-3)21-22-17(26)13(9-24(27)10-25)8-12-6-4-5-7-12/h10,12-13,27H,4-9H2,1-3H3,(H,22,26)(H,19,20,21)/t13-/m0/s1 |
| InChIKey | OPAJORMMJBWQJK-ZDUSSCGKSA-N |
| XLogP | 1.41 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|