C24H38FN7O3 — CID 87210436
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(4-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 87210436) has the molecular formula C24H38FN7O3 and a molecular weight of 491.61 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(4-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(4-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87210436 |
| Molecular Formula | C24H38FN7O3 |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(4-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N2CCN(C)C3CCCCC32)n1 |
| InChI | InChI=1S/C24H38FN7O3/c1-16-26-22(28-29-24(34)18(14-31(35)15-33)13-17-7-3-4-8-17)21(25)23(27-16)32-12-11-30(2)19-9-5-6-10-20(19)32/h15,17-20,35H,3-14H2,1-2H3,(H,29,34)(H,26,27,28)/t18-,19?,20?/m1/s1 |
| InChIKey | OYNCSZCGLPFAKM-XEVCZEQESA-N |
| XLogP | 2.47 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|