C18H27FN6O3S — CID 58000775
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(1,3-thiazolidin-3-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000775) has the molecular formula C18H27FN6O3S and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(1,3-thiazolidin-3-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(1,3-thiazolidin-3-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000775 |
| Molecular Formula | C18H27FN6O3S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[5-fluoro-2-methyl-6-(1,3-thiazolidin-3-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | Cc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N2CCSC2)n1 |
| InChI | InChI=1S/C18H27FN6O3S/c1-12-20-16(15(19)17(21-12)24-6-7-29-11-24)22-23-18(27)14(9-25(28)10-26)8-13-4-2-3-5-13/h10,13-14,28H,2-9,11H2,1H3,(H,23,27)(H,20,21,22)/t14-/m1/s1 |
| InChIKey | COUMADFMPPCJEM-CQSZACIVSA-N |
| XLogP | 1.92 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|