C20H31FN6O3 — CID 87209993
N-[(2S)-3-[2-[6-(cyclopentylamino)-5-fluoro-2-methylpyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide (PubChem CID 87209993) has the molecular formula C20H31FN6O3 and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[(2S)-3-[2-[6-(cyclopentylamino)-5-fluoro-2-methylpyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-3-[2-[6-(cyclopentylamino)-5-fluoro-2-methylpyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87209993 |
| Molecular Formula | C20H31FN6O3 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-[(2S)-3-[2-[6-(cyclopentylamino)-5-fluoro-2-methylpyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
| SMILES | Cc1nc(NNC(=O)[C@@H](CC2CCCC2)CN(O)C=O)c(F)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C20H31FN6O3/c1-13-22-18(24-16-8-4-5-9-16)17(21)19(23-13)25-26-20(29)15(11-27(30)12-28)10-14-6-2-3-7-14/h12,14-16,30H,2-11H2,1H3,(H,26,29)(H2,22,23,24,25)/t15-/m0/s1 |
| InChIKey | UGAADOAYKDQPHT-HNNXBMFYSA-N |
| XLogP | 2.77 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|