C19H29ClFN7O3 — CID 58000511
N-[(2R)-3-[2-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclobutylmethyl)-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000511) has the molecular formula C19H29ClFN7O3 and a molecular weight of 457.94 g/mol. Its IUPAC name is N-[(2R)-3-[2-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclobutylmethyl)-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-3-[2-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclobutylmethyl)-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000511 |
| Molecular Formula | C19H29ClFN7O3 |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[(2R)-3-[2-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclobutylmethyl)-3-oxopropyl]-N-hydroxyformamide |
| SMILES | C[C@@H]1CN(C)CCN1c1nc(Cl)nc(NNC(=O)[C@H](CC2CCC2)CN(O)C=O)c1F |
| InChI | InChI=1S/C19H29ClFN7O3/c1-12-9-26(2)6-7-28(12)17-15(21)16(22-19(20)23-17)24-25-18(30)14(10-27(31)11-29)8-13-4-3-5-13/h11-14,31H,3-10H2,1-2H3,(H,25,30)(H,22,23,24)/t12-,14-/m1/s1 |
| InChIKey | LKOHUOUPRGTJBB-TZMCWYRMSA-N |
| XLogP | 1.51 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|