C17H26F2N6O3 — CID 58000518
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(dimethylamino)-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000518) has the molecular formula C17H26F2N6O3 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(dimethylamino)-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(dimethylamino)-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000518 |
| Molecular Formula | C17H26F2N6O3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(dimethylamino)-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | CN(C)c1nc(CF)nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c1F |
| InChI | InChI=1S/C17H26F2N6O3/c1-24(2)16-14(19)15(20-13(8-18)21-16)22-23-17(27)12(9-25(28)10-26)7-11-5-3-4-6-11/h10-12,28H,3-9H2,1-2H3,(H,23,27)(H,20,21,22)/t12-/m1/s1 |
| InChIKey | XMLSOQQXAUXJQY-GFCCVEGCSA-N |
| XLogP | 1.64 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|