C18H26ClFN6O3 — CID 58000514
N-[(2R)-3-[2-(2-chloro-5-fluoro-6-pyrrolidin-1-ylpyrimidin-4-yl)hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000514) has the molecular formula C18H26ClFN6O3 and a molecular weight of 428.90 g/mol. Its IUPAC name is N-[(2R)-3-[2-(2-chloro-5-fluoro-6-pyrrolidin-1-ylpyrimidin-4-yl)hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-3-[2-(2-chloro-5-fluoro-6-pyrrolidin-1-ylpyrimidin-4-yl)hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000514 |
| Molecular Formula | C18H26ClFN6O3 |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[(2R)-3-[2-(2-chloro-5-fluoro-6-pyrrolidin-1-ylpyrimidin-4-yl)hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
| SMILES | O=CN(O)C[C@@H](CC1CCCC1)C(=O)NNc1nc(Cl)nc(N2CCCC2)c1F |
| InChI | InChI=1S/C18H26ClFN6O3/c19-18-21-15(14(20)16(22-18)25-7-3-4-8-25)23-24-17(28)13(10-26(29)11-27)9-12-5-1-2-6-12/h11-13,29H,1-10H2,(H,24,28)(H,21,22,23)/t13-/m1/s1 |
| InChIKey | QZEDOBUPKJICSP-CYBMUJFWSA-N |
| XLogP | 2.36 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|