C18H25F3N6O3 — CID 58000521
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(cyclopropylamino)-2-(difluoromethyl)-5-fluoropyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000521) has the molecular formula C18H25F3N6O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(cyclopropylamino)-2-(difluoromethyl)-5-fluoropyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(cyclopropylamino)-2-(difluoromethyl)-5-fluoropyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000521 |
| Molecular Formula | C18H25F3N6O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-(cyclopropylamino)-2-(difluoromethyl)-5-fluoropyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | O=CN(O)C[C@@H](CC1CCCC1)C(=O)NNc1nc(C(F)F)nc(NC2CC2)c1F |
| InChI | InChI=1S/C18H25F3N6O3/c19-13-15(22-12-5-6-12)23-17(14(20)21)24-16(13)25-26-18(29)11(8-27(30)9-28)7-10-3-1-2-4-10/h9-12,14,30H,1-8H2,(H,26,29)(H2,22,23,24,25)/t11-/m1/s1 |
| InChIKey | CUBOEAAXTCNQTJ-LLVKDONJSA-N |
| XLogP | 2.61 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|