C32H40N3O7P — CID 163557157
N-[[[2-butyl-1-[[formyl(phenylmethoxy)amino]methyl]cyclopropanecarbonyl]amino]methyl]-5-[3-[ethoxy(methyl)phosphoryl]phenyl]furan-2-carboxamide (PubChem CID 163557157) has the molecular formula C32H40N3O7P and a molecular weight of 609.66 g/mol. Its IUPAC name is N-[[[2-butyl-1-[[formyl(phenylmethoxy)amino]methyl]cyclopropanecarbonyl]amino]methyl]-5-[3-[ethoxy(methyl)phosphoryl]phenyl]furan-2-carboxamide.
| Compound Name | N-[[[2-butyl-1-[[formyl(phenylmethoxy)amino]methyl]cyclopropanecarbonyl]amino]methyl]-5-[3-[ethoxy(methyl)phosphoryl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 163557157 |
| Molecular Formula | C32H40N3O7P |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | N-[[[2-butyl-1-[[formyl(phenylmethoxy)amino]methyl]cyclopropanecarbonyl]amino]methyl]-5-[3-[ethoxy(methyl)phosphoryl]phenyl]furan-2-carboxamide |
| SMILES | CCCCC1CC1(CN(C=O)OCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cccc(P(C)(=O)OCC)c2)o1 |
| InChI | InChI=1S/C32H40N3O7P/c1-4-6-14-26-19-32(26,21-35(23-36)40-20-24-11-8-7-9-12-24)31(38)34-22-33-30(37)29-17-16-28(42-29)25-13-10-15-27(18-25)43(3,39)41-5-2/h7-13,15-18,23,26H,4-6,14,19-22H2,1-3H3,(H,33,37)(H,34,38) |
| InChIKey | FOBKXSNHFHSJJX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|