C23H37N3O4 — CID 59902207
(2R)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide (PubChem CID 59902207) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide.
| Compound Name | (2R)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 59902207 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (2R)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
| SMILES | CCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)N[C@H](C(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H37N3O4/c1-7-8-14-19(15-26(17-27)30-16-18-12-10-9-11-13-18)21(28)24-20(23(2,3)4)22(29)25(5)6/h9-13,17,19-20H,7-8,14-16H2,1-6H3,(H,24,28)/t19-,20-/m1/s1 |
| InChIKey | PVWNZEQYAQYOIG-WOJBJXKFSA-N |
| XLogP | 3.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|