C21H20F5NO4 — CID 22096238
(2,3,4,5,6-pentafluorophenyl) 2-[[formyl(phenylmethoxy)amino]methyl]hexanoate (PubChem CID 22096238) has the molecular formula C21H20F5NO4 and a molecular weight of 445.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[[formyl(phenylmethoxy)amino]methyl]hexanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[[formyl(phenylmethoxy)amino]methyl]hexanoate |
|---|---|
| PubChem CID | 22096238 |
| Molecular Formula | C21H20F5NO4 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[[formyl(phenylmethoxy)amino]methyl]hexanoate |
| SMILES | CCCCC(CN(C=O)OCc1ccccc1)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H20F5NO4/c1-2-3-9-14(10-27(12-28)30-11-13-7-5-4-6-8-13)21(29)31-20-18(25)16(23)15(22)17(24)19(20)26/h4-8,12,14H,2-3,9-11H2,1H3 |
| InChIKey | FPQDPGPRQDPIDT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|