C27H36N2O5 — CID 21305304
2-[[formyl(phenylmethoxy)amino]methyl]-N-[1-(4-hydroxyphenyl)-3,3-dimethyl-1-oxobutan-2-yl]hexanamide (PubChem CID 21305304) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-[[formyl(phenylmethoxy)amino]methyl]-N-[1-(4-hydroxyphenyl)-3,3-dimethyl-1-oxobutan-2-yl]hexanamide.
| Compound Name | 2-[[formyl(phenylmethoxy)amino]methyl]-N-[1-(4-hydroxyphenyl)-3,3-dimethyl-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 21305304 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 2-[[formyl(phenylmethoxy)amino]methyl]-N-[1-(4-hydroxyphenyl)-3,3-dimethyl-1-oxobutan-2-yl]hexanamide |
| SMILES | CCCCC(CN(C=O)OCc1ccccc1)C(=O)NC(C(=O)c1ccc(O)cc1)C(C)(C)C |
| InChI | InChI=1S/C27H36N2O5/c1-5-6-12-22(17-29(19-30)34-18-20-10-8-7-9-11-20)26(33)28-25(27(2,3)4)24(32)21-13-15-23(31)16-14-21/h7-11,13-16,19,22,25,31H,5-6,12,17-18H2,1-4H3,(H,28,33) |
| InChIKey | QNLZIJMYOLQURI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|