C26H41N3O4 — CID 20752860
N-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide (PubChem CID 20752860) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide.
| Compound Name | N-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 20752860 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | N-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
| SMILES | CCCCC(CN(C=O)OCc1ccccc1)C(=O)NC(C(=O)N1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C26H41N3O4/c1-5-6-15-22(18-29(20-30)33-19-21-13-9-7-10-14-21)24(31)27-23(26(2,3)4)25(32)28-16-11-8-12-17-28/h7,9-10,13-14,20,22-23H,5-6,8,11-12,15-19H2,1-4H3,(H,27,31) |
| InChIKey | WGBBYWMZJUVIGV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|