C22H37N3O4 — CID 101132423
(2S)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[hydroxy(phenylmethoxy)amino]methyl]hexanamide (PubChem CID 101132423) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[hydroxy(phenylmethoxy)amino]methyl]hexanamide.
| Compound Name | (2S)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[hydroxy(phenylmethoxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 101132423 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (2S)-N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[hydroxy(phenylmethoxy)amino]methyl]hexanamide |
| SMILES | CCCC[C@@H](CN(O)OCc1ccccc1)C(=O)N[C@H](C(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H37N3O4/c1-7-8-14-18(15-25(28)29-16-17-12-10-9-11-13-17)20(26)23-19(22(2,3)4)21(27)24(5)6/h9-13,18-19,28H,7-8,14-16H2,1-6H3,(H,23,26)/t18-,19+/m0/s1 |
| InChIKey | KPPHAHDPFYGVKH-RBUKOAKNSA-N |
| XLogP | 3.23 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|