C22H33N3O6 — CID 87947779
benzyl 2-(dimethylcarbamoyl)-4-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]butanoate (PubChem CID 87947779) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is benzyl 2-(dimethylcarbamoyl)-4-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]butanoate.
| Compound Name | benzyl 2-(dimethylcarbamoyl)-4-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]butanoate |
|---|---|
| PubChem CID | 87947779 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | benzyl 2-(dimethylcarbamoyl)-4-[2-[[formyl(hydroxy)amino]methyl]hexanoylamino]butanoate |
| SMILES | CCCCC(CN(O)C=O)C(=O)NCCC(C(=O)OCc1ccccc1)C(=O)N(C)C |
| InChI | InChI=1S/C22H33N3O6/c1-4-5-11-18(14-25(30)16-26)20(27)23-13-12-19(21(28)24(2)3)22(29)31-15-17-9-7-6-8-10-17/h6-10,16,18-19,30H,4-5,11-15H2,1-3H3,(H,23,27) |
| InChIKey | DSWMYDALZHZCFV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|