C16H31N3O4 — CID 22096280
N-[1-(dimethylamino)-3-methyl-1-oxopentan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide (PubChem CID 22096280) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[1-(dimethylamino)-3-methyl-1-oxopentan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide.
| Compound Name | N-[1-(dimethylamino)-3-methyl-1-oxopentan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 22096280 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | N-[1-(dimethylamino)-3-methyl-1-oxopentan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide |
| SMILES | CCCCC(CN(O)C=O)C(=O)NC(C(=O)N(C)C)C(C)CC |
| InChI | InChI=1S/C16H31N3O4/c1-6-8-9-13(10-19(23)11-20)15(21)17-14(12(3)7-2)16(22)18(4)5/h11-14,23H,6-10H2,1-5H3,(H,17,21) |
| InChIKey | HCVHTIQDTZGXED-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|