C9H17NO3 — CID 142881718
N-(2-acetylhexyl)-N-hydroxyformamide (PubChem CID 142881718) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is N-(2-acetylhexyl)-N-hydroxyformamide.
| Compound Name | N-(2-acetylhexyl)-N-hydroxyformamide |
|---|---|
| PubChem CID | 142881718 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | N-(2-acetylhexyl)-N-hydroxyformamide |
| SMILES | CCCCC(CN(O)C=O)C(C)=O |
| InChI | InChI=1S/C9H17NO3/c1-3-4-5-9(8(2)12)6-10(13)7-11/h7,9,13H,3-6H2,1-2H3 |
| InChIKey | OOBOEYQOPURIBU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|