C13H20N2O4 — CID 138641122
N-[(2R)-2-[(2S)-2-formyl-2,5-dihydropyrrole-1-carbonyl]hexyl]-N-hydroxyformamide (PubChem CID 138641122) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[(2R)-2-[(2S)-2-formyl-2,5-dihydropyrrole-1-carbonyl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[(2S)-2-formyl-2,5-dihydropyrrole-1-carbonyl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 138641122 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[(2R)-2-[(2S)-2-formyl-2,5-dihydropyrrole-1-carbonyl]hexyl]-N-hydroxyformamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CC=C[C@H]1C=O |
| InChI | InChI=1S/C13H20N2O4/c1-2-3-5-11(8-14(19)10-17)13(18)15-7-4-6-12(15)9-16/h4,6,9-12,19H,2-3,5,7-8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | KKSHYVQEGOORLA-NEPJUHHUSA-N |
| XLogP | 0.61 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|