C21H31N4O5+ — CID 157415808
(6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-(1-hydroxy-5-methylpyridin-1-ium-2-yl)-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 157415808) has the molecular formula C21H31N4O5+ and a molecular weight of 419.50 g/mol. Its IUPAC name is (6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-(1-hydroxy-5-methylpyridin-1-ium-2-yl)-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | (6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-(1-hydroxy-5-methylpyridin-1-ium-2-yl)-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 157415808 |
| Molecular Formula | C21H31N4O5+ |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-(1-hydroxy-5-methylpyridin-1-ium-2-yl)-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CC2(CC2)C[C@H]1C(=O)Nc1ccc(C)c[n+]1O |
| InChI | InChI=1S/C21H30N4O5/c1-3-4-5-16(12-23(29)14-26)20(28)24-13-21(8-9-21)10-17(24)19(27)22-18-7-6-15(2)11-25(18)30/h6-7,11,14,16-17,29-30H,3-5,8-10,12-13H2,1-2H3/p+1/t16-,17+/m1/s1 |
| InChIKey | VPHNEGGGHGVLCL-SJORKVTESA-O |
| XLogP | 1.49 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|