C15H24N2O4 — CID 138641157
N-[(2R)-2-[(6S)-6-formyl-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]-N-hydroxyformamide (PubChem CID 138641157) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[(2R)-2-[(6S)-6-formyl-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[(6S)-6-formyl-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 138641157 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[(2R)-2-[(6S)-6-formyl-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]-N-hydroxyformamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CC2(CC2)C[C@H]1C=O |
| InChI | InChI=1S/C15H24N2O4/c1-2-3-4-12(8-16(21)11-19)14(20)17-10-15(5-6-15)7-13(17)9-18/h9,11-13,21H,2-8,10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | LMOQZGXUMHCLMV-OLZOCXBDSA-N |
| XLogP | 1.22 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|