C19H25FN4O3 — CID 58016156
N-[(2R)-2-[(2S)-2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide (PubChem CID 58016156) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[(2R)-2-[(2S)-2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[(2S)-2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58016156 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[(2R)-2-[(2S)-2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CCC[C@H]1c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C19H25FN4O3/c1-2-3-5-13(11-23(27)12-25)19(26)24-9-4-6-17(24)18-21-15-8-7-14(20)10-16(15)22-18/h7-8,10,12-13,17,27H,2-6,9,11H2,1H3,(H,21,22)/t13-,17+/m1/s1 |
| InChIKey | WQUHGSZNIYDNHX-DYVFJYSZSA-N |
| XLogP | 3.02 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|