C19H24ClN3O4 — CID 58016170
N-[(2R)-2-[(2S)-2-(6-chloro-1,3-benzoxazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide (PubChem CID 58016170) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is N-[(2R)-2-[(2S)-2-(6-chloro-1,3-benzoxazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[(2S)-2-(6-chloro-1,3-benzoxazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58016170 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(2R)-2-[(2S)-2-(6-chloro-1,3-benzoxazol-2-yl)pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CCC[C@H]1c1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-2-3-5-13(11-22(26)12-24)19(25)23-9-4-6-16(23)18-21-15-8-7-14(20)10-17(15)27-18/h7-8,10,12-13,16,26H,2-6,9,11H2,1H3/t13-,16+/m1/s1 |
| InChIKey | FPMHEAABKWHGRK-CJNGLKHVSA-N |
| XLogP | 3.80 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|