C19H25N5O5 — CID 143500352
N-hydroxy-N-[2-[(2S)-2-(6-nitro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]formamide (PubChem CID 143500352) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-hydroxy-N-[2-[(2S)-2-(6-nitro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]formamide.
| Compound Name | N-hydroxy-N-[2-[(2S)-2-(6-nitro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]formamide |
|---|---|
| PubChem CID | 143500352 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-hydroxy-N-[2-[(2S)-2-(6-nitro-1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]hexyl]formamide |
| SMILES | CCCCC(CN(O)C=O)C(=O)N1CCC[C@H]1c1nc2ccc([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C19H25N5O5/c1-2-3-5-13(11-22(27)12-25)19(26)23-9-4-6-17(23)18-20-15-8-7-14(24(28)29)10-16(15)21-18/h7-8,10,12-13,17,27H,2-6,9,11H2,1H3,(H,20,21)/t13?,17-/m0/s1 |
| InChIKey | SAZKWWQMRHTQNR-RUINGEJQSA-N |
| XLogP | 2.79 |
| TPSA | 132.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|