C25H22N4O4 — CID 25262357
benzyl (2R)-2-[6-(4-nitrophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 25262357) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is benzyl (2R)-2-[6-(4-nitrophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[6-(4-nitrophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 25262357 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | benzyl (2R)-2-[6-(4-nitrophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@@H]1c1nc2ccc(-c3ccc([N+](=O)[O-])cc3)cc2[nH]1 |
| InChI | InChI=1S/C25H22N4O4/c30-25(33-16-17-5-2-1-3-6-17)28-14-4-7-23(28)24-26-21-13-10-19(15-22(21)27-24)18-8-11-20(12-9-18)29(31)32/h1-3,5-6,8-13,15,23H,4,7,14,16H2,(H,26,27)/t23-/m1/s1 |
| InChIKey | XVNONJVEMLSJPT-HSZRJFAPSA-N |
| XLogP | 5.61 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|