C29H32BN3O3 — CID 89056405
CID 89056405 (PubChem CID 89056405) has the molecular formula C29H32BN3O3 and a molecular weight of 481.41 g/mol.
| Compound Name | CID 89056405 |
|---|---|
| PubChem CID | 89056405 |
| Molecular Formula | C29H32BN3O3 |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)C12CCC(c3ccc4nc(C5CCCN5C(=O)OCc5ccccc5)[nH]c4c3)(CC1)CC2 |
| InChI | InChI=1S/C29H32BN3O3/c30-18-25(34)29-13-10-28(11-14-29,12-15-29)21-8-9-22-23(17-21)32-26(31-22)24-7-4-16-33(24)27(35)36-19-20-5-2-1-3-6-20/h1-3,5-6,8-9,17,24H,4,7,10-16,18-19H2,(H,31,32) |
| InChIKey | RJEPIYZTOKSFCC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|