C26H22N4O2 — CID 68553080
benzyl 2-[6-(4-cyanophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 68553080) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is benzyl 2-[6-(4-cyanophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[6-(4-cyanophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68553080 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | benzyl 2-[6-(4-cyanophenyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | N#Cc1ccc(-c2ccc3nc(C4CCCN4C(=O)OCc4ccccc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C26H22N4O2/c27-16-18-8-10-20(11-9-18)21-12-13-22-23(15-21)29-25(28-22)24-7-4-14-30(24)26(31)32-17-19-5-2-1-3-6-19/h1-3,5-6,8-13,15,24H,4,7,14,17H2,(H,28,29) |
| InChIKey | FVNPQJABNGOHJT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |