C25H31N5O5S — CID 58016089
N-[(2R)-2-[(2S)-2-[6-(benzenesulfonamido)-1H-benzimidazol-2-yl]pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide (PubChem CID 58016089) has the molecular formula C25H31N5O5S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-[(2R)-2-[(2S)-2-[6-(benzenesulfonamido)-1H-benzimidazol-2-yl]pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[(2S)-2-[6-(benzenesulfonamido)-1H-benzimidazol-2-yl]pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58016089 |
| Molecular Formula | C25H31N5O5S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N-[(2R)-2-[(2S)-2-[6-(benzenesulfonamido)-1H-benzimidazol-2-yl]pyrrolidine-1-carbonyl]hexyl]-N-hydroxyformamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CCC[C@H]1c1nc2ccc(NS(=O)(=O)c3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C25H31N5O5S/c1-2-3-8-18(16-29(33)17-31)25(32)30-14-7-11-23(30)24-26-21-13-12-19(15-22(21)27-24)28-36(34,35)20-9-5-4-6-10-20/h4-6,9-10,12-13,15,17-18,23,28,33H,2-3,7-8,11,14,16H2,1H3,(H,26,27)/t18-,23+/m1/s1 |
| InChIKey | VAYGFORQROLUKI-JPYJTQIMSA-N |
| XLogP | 3.68 |
| TPSA | 135.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|