C19H28N4O5 — CID 138607245
(6S)-5-[(3R)-3-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-(1,2-oxazol-5-yl)-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 138607245) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is (6S)-5-[(3R)-3-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-(1,2-oxazol-5-yl)-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | (6S)-5-[(3R)-3-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-(1,2-oxazol-5-yl)-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 138607245 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (6S)-5-[(3R)-3-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-(1,2-oxazol-5-yl)-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | CCCC[C@H](CC(=O)N1CC2(CC2)C[C@H]1C(=O)Nc1ccno1)CN(O)C=O |
| InChI | InChI=1S/C19H28N4O5/c1-2-3-4-14(11-22(27)13-24)9-17(25)23-12-19(6-7-19)10-15(23)18(26)21-16-5-8-20-28-16/h5,8,13-15,27H,2-4,6-7,9-12H2,1H3,(H,21,26)/t14-,15+/m1/s1 |
| InChIKey | KMKSKMHCZDBKOG-CABCVRRESA-N |
| XLogP | 2.04 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|