C19H25F3N4O4 — CID 162540477
1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide (PubChem CID 162540477) has the molecular formula C19H25F3N4O4 and a molecular weight of 430.43 g/mol. Its IUPAC name is 1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162540477 |
| Molecular Formula | C19H25F3N4O4 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CCCC1C(=O)Nc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C19H25F3N4O4/c1-2-3-5-13(11-25(30)12-27)18(29)26-9-4-6-15(26)17(28)24-16-10-14(7-8-23-16)19(20,21)22/h7-8,10,12-13,15,30H,2-6,9,11H2,1H3,(H,23,24,28)/t13-,15?/m1/s1 |
| InChIKey | SZHQAHJBONVHSD-AFYYWNPRSA-N |
| XLogP | 2.68 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|