C21H32FN5O4 — CID 143338723
(2S,5R)-5-fluoro-1-[2-[[formyl(hydroxy)amino]methyl]nonanoyl]-N-pyrazin-2-ylpiperidine-2-carboxamide (PubChem CID 143338723) has the molecular formula C21H32FN5O4 and a molecular weight of 437.52 g/mol. Its IUPAC name is (2S,5R)-5-fluoro-1-[2-[[formyl(hydroxy)amino]methyl]nonanoyl]-N-pyrazin-2-ylpiperidine-2-carboxamide.
| Compound Name | (2S,5R)-5-fluoro-1-[2-[[formyl(hydroxy)amino]methyl]nonanoyl]-N-pyrazin-2-ylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 143338723 |
| Molecular Formula | C21H32FN5O4 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (2S,5R)-5-fluoro-1-[2-[[formyl(hydroxy)amino]methyl]nonanoyl]-N-pyrazin-2-ylpiperidine-2-carboxamide |
| SMILES | CCCCCCCC(CN(O)C=O)C(=O)N1C[C@H](F)CC[C@H]1C(=O)Nc1cnccn1 |
| InChI | InChI=1S/C21H32FN5O4/c1-2-3-4-5-6-7-16(13-26(31)15-28)21(30)27-14-17(22)8-9-18(27)20(29)25-19-12-23-10-11-24-19/h10-12,15-18,31H,2-9,13-14H2,1H3,(H,24,25,29)/t16?,17-,18+/m1/s1 |
| InChIKey | GUHFKWMVSKHPCX-RWZMTBSZSA-N |
| XLogP | 2.57 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|