C20H29N5O4 — CID 138728803
(6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-pyrimidin-4-yl-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 138728803) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is (6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-pyrimidin-4-yl-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | (6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-pyrimidin-4-yl-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 138728803 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (6S)-5-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]-N-pyrimidin-4-yl-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)N1CC2(CC2)C[C@H]1C(=O)Nc1ccncn1 |
| InChI | InChI=1S/C20H29N5O4/c1-2-3-4-5-15(11-24(29)14-26)19(28)25-12-20(7-8-20)10-16(25)18(27)23-17-6-9-21-13-22-17/h6,9,13-16,29H,2-5,7-8,10-12H2,1H3,(H,21,22,23,27)/t15-,16+/m1/s1 |
| InChIKey | UUNIPAVHNFKGSE-CVEARBPZSA-N |
| XLogP | 1.84 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|