C17H24FN5O4 — CID 24849322
(2S,4R)-4-fluoro-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-pyrazin-2-ylpyrrolidine-2-carboxamide (PubChem CID 24849322) has the molecular formula C17H24FN5O4 and a molecular weight of 381.41 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-pyrazin-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-fluoro-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-pyrazin-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24849322 |
| Molecular Formula | C17H24FN5O4 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2S,4R)-4-fluoro-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-pyrazin-2-ylpyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1C[C@H](F)C[C@H]1C(=O)Nc1cnccn1 |
| InChI | InChI=1S/C17H24FN5O4/c1-2-3-4-12(9-22(27)11-24)17(26)23-10-13(18)7-14(23)16(25)21-15-8-19-5-6-20-15/h5-6,8,11-14,27H,2-4,7,9-10H2,1H3,(H,20,21,25)/t12-,13-,14+/m1/s1 |
| InChIKey | PCTAVCRDYMXJEV-MCIONIFRSA-N |
| XLogP | 1.01 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|