C20H29N4O4- — CID 142946667
(2S)-N-(4-ethyl-2-pyridinyl)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 142946667) has the molecular formula C20H29N4O4- and a molecular weight of 389.48 g/mol. Its IUPAC name is (2S)-N-(4-ethyl-2-pyridinyl)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-ethyl-2-pyridinyl)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142946667 |
| Molecular Formula | C20H29N4O4- |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (2S)-N-(4-ethyl-2-pyridinyl)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN([O-])C=O)C(=O)N1CCC[C@H]1C(=O)Nc1cc(CC)ccn1 |
| InChI | InChI=1S/C20H29N4O4/c1-3-5-7-16(13-23(28)14-25)20(27)24-11-6-8-17(24)19(26)22-18-12-15(4-2)9-10-21-18/h9-10,12,14,16-17H,3-8,11,13H2,1-2H3,(H,21,22,26)/q-1/t16-,17+/m1/s1 |
| InChIKey | ITGGAFPPDVXMMD-SJORKVTESA-N |
| XLogP | 2.34 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|