C32H38N4O5 — CID 58763267
(2S)-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]-N-(6-phenylmethoxy-2-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 58763267) has the molecular formula C32H38N4O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]-N-(6-phenylmethoxy-2-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]-N-(6-phenylmethoxy-2-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58763267 |
| Molecular Formula | C32H38N4O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | (2S)-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]-N-(6-phenylmethoxy-2-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)Nc1cccc(OCc2ccccc2)n1 |
| InChI | InChI=1S/C32H38N4O5/c1-2-3-16-27(21-35(24-37)41-23-26-14-8-5-9-15-26)32(39)36-20-11-17-28(36)31(38)34-29-18-10-19-30(33-29)40-22-25-12-6-4-7-13-25/h4-10,12-15,18-19,24,27-28H,2-3,11,16-17,20-23H2,1H3,(H,33,34,38)/t27-,28+/m1/s1 |
| InChIKey | UEBGILFNKDSWFS-IZLXSDGUSA-N |
| XLogP | 4.99 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|