C25H32FN5O4 — CID 88923190
(3S)-N-(5-fluoro-2-pyridinyl)-2-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]pyrazolidine-3-carboxamide (PubChem CID 88923190) has the molecular formula C25H32FN5O4 and a molecular weight of 485.56 g/mol. Its IUPAC name is (3S)-N-(5-fluoro-2-pyridinyl)-2-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]pyrazolidine-3-carboxamide.
| Compound Name | (3S)-N-(5-fluoro-2-pyridinyl)-2-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 88923190 |
| Molecular Formula | C25H32FN5O4 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | (3S)-N-(5-fluoro-2-pyridinyl)-2-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]pyrazolidine-3-carboxamide |
| SMILES | CCCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)N1NCC[C@H]1C(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C25H32FN5O4/c1-2-3-5-10-20(16-30(18-32)35-17-19-8-6-4-7-9-19)25(34)31-22(13-14-28-31)24(33)29-23-12-11-21(26)15-27-23/h4,6-9,11-12,15,18,20,22,28H,2-3,5,10,13-14,16-17H2,1H3,(H,27,29,33)/t20-,22+/m1/s1 |
| InChIKey | GYJDUCBGHPCIPO-IRLDBZIGSA-N |
| XLogP | 3.05 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|