C26H33N5O5 — CID 66547740
(3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[5-(4-methoxyphenyl)-2-pyridinyl]pyrazolidine-3-carboxamide (PubChem CID 66547740) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[5-(4-methoxyphenyl)-2-pyridinyl]pyrazolidine-3-carboxamide.
| Compound Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[5-(4-methoxyphenyl)-2-pyridinyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 66547740 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[5-(4-methoxyphenyl)-2-pyridinyl]pyrazolidine-3-carboxamide |
| SMILES | COc1ccc(-c2ccc(NC(=O)[C@@H]3CCNN3C(=O)[C@H](CC3CCCC3)CN(O)C=O)nc2)cc1 |
| InChI | InChI=1S/C26H33N5O5/c1-36-22-9-6-19(7-10-22)20-8-11-24(27-15-20)29-25(33)23-12-13-28-31(23)26(34)21(16-30(35)17-32)14-18-4-2-3-5-18/h6-11,15,17-18,21,23,28,35H,2-5,12-14,16H2,1H3,(H,27,29,33)/t21-,23+/m1/s1 |
| InChIKey | JLQYBXXIUGEZCD-GGAORHGYSA-N |
| XLogP | 2.85 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|