C20H28N8O4 — CID 77137546
2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(7-methylpurin-6-yl)pyrazolidine-3-carboxamide (PubChem CID 77137546) has the molecular formula C20H28N8O4 and a molecular weight of 444.50 g/mol. Its IUPAC name is 2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(7-methylpurin-6-yl)pyrazolidine-3-carboxamide.
| Compound Name | 2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(7-methylpurin-6-yl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 77137546 |
| Molecular Formula | C20H28N8O4 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(7-methylpurin-6-yl)pyrazolidine-3-carboxamide |
| SMILES | Cn1cnc2ncnc(NC(=O)C3CCNN3C(=O)C(CC3CCCC3)CN(O)C=O)c21 |
| InChI | InChI=1S/C20H28N8O4/c1-26-11-23-17-16(26)18(22-10-21-17)25-19(30)15-6-7-24-28(15)20(31)14(9-27(32)12-29)8-13-4-2-3-5-13/h10-15,24,32H,2-9H2,1H3,(H,21,22,25,30) |
| InChIKey | QOKYWLPLCIRCLN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|