C19H26FN5O4 — CID 146803527
N-[(2R)-2-(cyclopentylmethyl)-3-[(5S)-5-[2-(5-fluoropyrimidin-2-yl)acetyl]pyrazolidin-1-yl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 146803527) has the molecular formula C19H26FN5O4 and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[(5S)-5-[2-(5-fluoropyrimidin-2-yl)acetyl]pyrazolidin-1-yl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[(5S)-5-[2-(5-fluoropyrimidin-2-yl)acetyl]pyrazolidin-1-yl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 146803527 |
| Molecular Formula | C19H26FN5O4 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[(5S)-5-[2-(5-fluoropyrimidin-2-yl)acetyl]pyrazolidin-1-yl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | O=CN(O)C[C@@H](CC1CCCC1)C(=O)N1NCC[C@H]1C(=O)Cc1ncc(F)cn1 |
| InChI | InChI=1S/C19H26FN5O4/c20-15-9-21-18(22-10-15)8-17(27)16-5-6-23-25(16)19(28)14(11-24(29)12-26)7-13-3-1-2-4-13/h9-10,12-14,16,23,29H,1-8,11H2/t14-,16+/m1/s1 |
| InChIKey | RYJUFNQNTJYKGM-ZBFHGGJFSA-N |
| XLogP | 0.88 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|