C25H33FN4O5 — CID 90688847
[6-[[5-[[formyl(phenylmethoxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite (PubChem CID 90688847) has the molecular formula C25H33FN4O5 and a molecular weight of 488.56 g/mol. Its IUPAC name is [6-[[5-[[formyl(phenylmethoxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite.
| Compound Name | [6-[[5-[[formyl(phenylmethoxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 90688847 |
| Molecular Formula | C25H33FN4O5 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [6-[[5-[[formyl(phenylmethoxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite |
| SMILES | CCCCC(CN(C=O)OCc1ccccc1)C(=O)C(NC(=O)Nc1ccc(OF)cn1)C(C)C |
| InChI | InChI=1S/C25H33FN4O5/c1-4-5-11-20(15-30(17-31)34-16-19-9-7-6-8-10-19)24(32)23(18(2)3)29-25(33)28-22-13-12-21(35-26)14-27-22/h6-10,12-14,17-18,20,23H,4-5,11,15-16H2,1-3H3,(H2,27,28,29,33) |
| InChIKey | FRQXPTIYCKGBGE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|