C26H35N3O4 — CID 22733599
N-(3,3-dimethyl-1-oxo-1-pyridin-2-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide (PubChem CID 22733599) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-oxo-1-pyridin-2-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide.
| Compound Name | N-(3,3-dimethyl-1-oxo-1-pyridin-2-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 22733599 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-(3,3-dimethyl-1-oxo-1-pyridin-2-ylbutan-2-yl)-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
| SMILES | CCCCC(CN(C=O)OCc1ccccc1)C(=O)NC(C(=O)c1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C26H35N3O4/c1-5-6-14-21(17-29(19-30)33-18-20-12-8-7-9-13-20)25(32)28-24(26(2,3)4)23(31)22-15-10-11-16-27-22/h7-13,15-16,19,21,24H,5-6,14,17-18H2,1-4H3,(H,28,32) |
| InChIKey | GIIAKFPKUSJXLP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|