C22H33N5O5 — CID 76652352
1-[2-[[formyl(oxan-2-yloxy)amino]methyl]hexanoyl]-N-pyridazin-3-ylpyrrolidine-2-carboxamide (PubChem CID 76652352) has the molecular formula C22H33N5O5 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[2-[[formyl(oxan-2-yloxy)amino]methyl]hexanoyl]-N-pyridazin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[[formyl(oxan-2-yloxy)amino]methyl]hexanoyl]-N-pyridazin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 76652352 |
| Molecular Formula | C22H33N5O5 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-[2-[[formyl(oxan-2-yloxy)amino]methyl]hexanoyl]-N-pyridazin-3-ylpyrrolidine-2-carboxamide |
| SMILES | CCCCC(CN(C=O)OC1CCCCO1)C(=O)N1CCCC1C(=O)Nc1cccnn1 |
| InChI | InChI=1S/C22H33N5O5/c1-2-3-8-17(15-26(16-28)32-20-11-4-5-14-31-20)22(30)27-13-7-9-18(27)21(29)24-19-10-6-12-23-25-19/h6,10,12,16-18,20H,2-5,7-9,11,13-15H2,1H3,(H,24,25,29) |
| InChIKey | KIBAZEUVDLEUBA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|