C25H32N4O5 — CID 58763324
(2S)-1-[(2R)-2-[[formyl(phenoxy)amino]methyl]hexanoyl]-N-(3-methoxy-2-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 58763324) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-[[formyl(phenoxy)amino]methyl]hexanoyl]-N-(3-methoxy-2-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-[[formyl(phenoxy)amino]methyl]hexanoyl]-N-(3-methoxy-2-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58763324 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (2S)-1-[(2R)-2-[[formyl(phenoxy)amino]methyl]hexanoyl]-N-(3-methoxy-2-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN(C=O)Oc1ccccc1)C(=O)N1CCC[C@H]1C(=O)Nc1ncccc1OC |
| InChI | InChI=1S/C25H32N4O5/c1-3-4-10-19(17-28(18-30)34-20-11-6-5-7-12-20)25(32)29-16-9-13-21(29)24(31)27-23-22(33-2)14-8-15-26-23/h5-8,11-12,14-15,18-19,21H,3-4,9-10,13,16-17H2,1-2H3,(H,26,27,31)/t19-,21+/m1/s1 |
| InChIKey | DOVAPDNFCMMBGE-CTNGQTDRSA-N |
| XLogP | 3.28 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|