C24H37N5O5 — CID 10390194
N-hydroxy-N-[(2R)-2-[(2S)-2-[4-(6-methoxy-2-pyridinyl)piperazine-1-carbonyl]pyrrolidine-1-carbonyl]heptyl]formamide (PubChem CID 10390194) has the molecular formula C24H37N5O5 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-hydroxy-N-[(2R)-2-[(2S)-2-[4-(6-methoxy-2-pyridinyl)piperazine-1-carbonyl]pyrrolidine-1-carbonyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[(2R)-2-[(2S)-2-[4-(6-methoxy-2-pyridinyl)piperazine-1-carbonyl]pyrrolidine-1-carbonyl]heptyl]formamide |
|---|---|
| PubChem CID | 10390194 |
| Molecular Formula | C24H37N5O5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | N-hydroxy-N-[(2R)-2-[(2S)-2-[4-(6-methoxy-2-pyridinyl)piperazine-1-carbonyl]pyrrolidine-1-carbonyl]heptyl]formamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)N1CCC[C@H]1C(=O)N1CCN(c2cccc(OC)n2)CC1 |
| InChI | InChI=1S/C24H37N5O5/c1-3-4-5-8-19(17-28(33)18-30)23(31)29-12-7-9-20(29)24(32)27-15-13-26(14-16-27)21-10-6-11-22(25-21)34-2/h6,10-11,18-20,33H,3-5,7-9,12-17H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | OPIAGZSAVROCKZ-UXHICEINSA-N |
| XLogP | 1.77 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|