C23H34FN3O2 — CID 42702663
2-ethyl-1-[2-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]hexan-1-one (PubChem CID 42702663) has the molecular formula C23H34FN3O2 and a molecular weight of 403.54 g/mol. Its IUPAC name is 2-ethyl-1-[2-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]hexan-1-one.
| Compound Name | 2-ethyl-1-[2-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 42702663 |
| Molecular Formula | C23H34FN3O2 |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 2-ethyl-1-[2-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]hexan-1-one |
| SMILES | CCCCC(CC)C(=O)N1CCCC1C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H34FN3O2/c1-3-5-9-18(4-2)22(28)27-13-8-12-21(27)23(29)26-16-14-25(15-17-26)20-11-7-6-10-19(20)24/h6-7,10-11,18,21H,3-5,8-9,12-17H2,1-2H3 |
| InChIKey | QDHBYGCUQPGOOV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |