C23H33FN4O5 — CID 25188709
(2S)-N-(3-fluoro-4-morpholin-4-ylphenyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 25188709) has the molecular formula C23H33FN4O5 and a molecular weight of 464.54 g/mol. Its IUPAC name is (2S)-N-(3-fluoro-4-morpholin-4-ylphenyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3-fluoro-4-morpholin-4-ylphenyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25188709 |
| Molecular Formula | C23H33FN4O5 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (2S)-N-(3-fluoro-4-morpholin-4-ylphenyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CCC[C@H]1C(=O)Nc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C23H33FN4O5/c1-2-3-5-17(15-27(32)16-29)23(31)28-9-4-6-21(28)22(30)25-18-7-8-20(19(24)14-18)26-10-12-33-13-11-26/h7-8,14,16-17,21,32H,2-6,9-13,15H2,1H3,(H,25,30)/t17-,21+/m1/s1 |
| InChIKey | JTFQBNXPHOCLCR-UTKZUKDTSA-N |
| XLogP | 2.25 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|