C20H29N3O5 — CID 25210734
(4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboxamide (PubChem CID 25210734) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is (4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboxamide.
| Compound Name | (4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 25210734 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (4S)-3-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-N-[(1S)-1-phenylethyl]-1,3-oxazolidine-4-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1COC[C@H]1C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H29N3O5/c1-3-4-8-17(11-22(27)13-24)20(26)23-14-28-12-18(23)19(25)21-15(2)16-9-6-5-7-10-16/h5-7,9-10,13,15,17-18,27H,3-4,8,11-12,14H2,1-2H3,(H,21,25)/t15-,17+,18-/m0/s1 |
| InChIKey | NPBVYHMYYPTXME-JQHSSLGASA-N |
| XLogP | 1.70 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|