C21H30N2O5 — CID 59918989
cyclopentyl 2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-phenylacetate (PubChem CID 59918989) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is cyclopentyl 2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-phenylacetate.
| Compound Name | cyclopentyl 2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 59918989 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | cyclopentyl 2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-phenylacetate |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)NC(C(=O)OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O5/c1-2-3-9-17(14-23(27)15-24)20(25)22-19(16-10-5-4-6-11-16)21(26)28-18-12-7-8-13-18/h4-6,10-11,15,17-19,27H,2-3,7-9,12-14H2,1H3,(H,22,25)/t17-,19?/m1/s1 |
| InChIKey | RPAATDRKFBYBOT-DUSLRRAJSA-N |
| XLogP | 2.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|