C25H38N2O5 — CID 142000333
[[(2R)-2-[[(2S)-1-cyclopentyloxy-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]hexyl]amino] benzoate (PubChem CID 142000333) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is [[(2R)-2-[[(2S)-1-cyclopentyloxy-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]hexyl]amino] benzoate.
| Compound Name | [[(2R)-2-[[(2S)-1-cyclopentyloxy-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]hexyl]amino] benzoate |
|---|---|
| PubChem CID | 142000333 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | [[(2R)-2-[[(2S)-1-cyclopentyloxy-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]hexyl]amino] benzoate |
| SMILES | CCCC[C@H](CNOC(=O)c1ccccc1)C(=O)N[C@H](C(=O)OC1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C25H38N2O5/c1-5-6-12-19(17-26-32-23(29)18-13-8-7-9-14-18)22(28)27-21(25(2,3)4)24(30)31-20-15-10-11-16-20/h7-9,13-14,19-21,26H,5-6,10-12,15-17H2,1-4H3,(H,27,28)/t19-,21-/m1/s1 |
| InChIKey | BNJOOQQKGJSCDF-TZIWHRDSSA-N |
| XLogP | 4.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|